Products 2901095-69-8
CAS 2901095-69-8 is the registry number for tert-Butyl 5-methyl-1H-pyrrolo[2,3-b]pyridine-1-carboxylate, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl 5-methylpyrrolo[2,3-b]pyridine-1-carboxylate (CAS 2901095-69-8) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: tert-butyl 5-methylpyrrolo[2,3-b]pyridine-1-carboxylate. InChIKey: HFGUSLZAJZEVEL-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | tert-butyl 5-methylpyrrolo[2,3-b]pyridine-1-carboxylate |
| InChIKey | HFGUSLZAJZEVEL-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N=C1)N(C=C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)