Products 290353-56-9
CAS 290353-56-9 appears in our catalog under these names: 1–Chloro–2–methyl–3，4–dinitrobenzene, 1-Chloro-2-methyl-3,4-dinitrobenzene 97%, 1-Chloro-2-methyl-3,4-dinitrobenzene, 97%, 97%, 1-Chloro-2-methyl-3,4-dinitrobenzene, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-chloro-2-methyl-3,4-dinitrobenzene (CAS 290353-56-9) is a chemical compound with the molecular formula C7H5ClN2O4 and a molecular weight of 216.58 g/mol. IUPAC name: 1-chloro-2-methyl-3,4-dinitrobenzene. InChIKey: VYTLFULGOMUAMK-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O4 |
|---|---|
| Molecular weight | 216.58 g/mol |
| IUPAC name | 1-chloro-2-methyl-3,4-dinitrobenzene |
| InChIKey | VYTLFULGOMUAMK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1[N+](=O)[O-])[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)