CAS 29080-58-8 appears in our catalog under these names: 7,3',4'-Tri-O-methylluteolin/ 98.66% (existing batch purity), 7,3',4'-Tri-O-methylluteolin, 99.28%. Offered by: TargetMol, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 5 mg.
2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one (CAS 29080-58-8) is a chemical compound with the molecular formula C18H16O6 and a molecular weight of 328.3 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one. InChIKey: HIXDQWDOVZUNNA-UHFFFAOYSA-N.
| Molecular formula | C18H16O6 |
|---|---|
| Molecular weight | 328.3 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one |
| InChIKey | HIXDQWDOVZUNNA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=O)C3=C(C=C(C=C3O2)OC)O)OC |
Computed by PubChem (NCBI)