Products 29096-76-2
CAS 29096-76-2 is the registry number for 1-(5,6-Dichloro-1H-1,3-benzodiazol-2-yl)methanamine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(5,6-dichloro-1H-benzimidazol-2-yl)methanamine (CAS 29096-76-2) is a chemical compound with the molecular formula C8H7Cl2N3 and a molecular weight of 216.06 g/mol. IUPAC name: (5,6-dichloro-1H-benzimidazol-2-yl)methanamine. InChIKey: ROLMMAUMZSFHNM-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2N3 |
|---|---|
| Molecular weight | 216.06 g/mol |
| IUPAC name | (5,6-dichloro-1H-benzimidazol-2-yl)methanamine |
| InChIKey | ROLMMAUMZSFHNM-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Cl)N=C(N2)CN |
Computed by PubChem (NCBI)