CAS 2913-97-5 appears in our catalog under these names: Phthalimidoacetaldehyde, >95% (HPLC), Phthalimidoacetaldehyde, Phthalimidoacetaldehyde, >98.0%(N), N-(2-Oxoethyl)phthalimide 98%, N-(2-Oxoethyl)phthalimide, 98%, 98%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 500mg, 100g, 5g, 10g, 25g, 500g, 1kg.
2-(1,3-dioxoisoindol-2-yl)acetaldehyde (CAS 2913-97-5) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 2-(1,3-dioxoisoindol-2-yl)acetaldehyde. InChIKey: LMRDBJZQDUVCQH-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 2-(1,3-dioxoisoindol-2-yl)acetaldehyde |
| InChIKey | LMRDBJZQDUVCQH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC=O |
Computed by PubChem (NCBI)