Products 2913404-05-2
CAS 2913404-05-2 is the registry number for 3-(2,6-dioxopiperidin-3-yl)-1-benzofuran-6-carbaldehyde, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
3-(2,6-dioxopiperidin-3-yl)-1-benzofuran-6-carbaldehyde (CAS 2913404-05-2) is a chemical compound with the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. IUPAC name: 3-(2,6-dioxopiperidin-3-yl)-1-benzofuran-6-carbaldehyde. InChIKey: ZGSUSIMQQGAUBX-UHFFFAOYSA-N.
| Molecular formula | C14H11NO4 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 3-(2,6-dioxopiperidin-3-yl)-1-benzofuran-6-carbaldehyde |
| InChIKey | ZGSUSIMQQGAUBX-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=COC3=C2C=CC(=C3)C=O |
Computed by PubChem (NCBI)