Products 2916869-58-2
CAS 2916869-58-2 is the registry number for ((1S,7AS)-1-methoxy-6-methylenetetrahydro-1H-pyrrolizin-7a(5H)-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1S,8S)-1-methoxy-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methanol (CAS 2916869-58-2) is a chemical compound with the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. IUPAC name: [(1S,8S)-1-methoxy-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methanol. InChIKey: QNEQTFCETYFZED-UWVGGRQHSA-N.
| Molecular formula | C10H17NO2 |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | [(1S,8S)-1-methoxy-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methanol |
| InChIKey | QNEQTFCETYFZED-UWVGGRQHSA-N |
| SMILES | CO[C@H]1CCN2[C@@]1(CC(=C)C2)CO |
Computed by PubChem (NCBI)