Products 2916869-83-3
CAS 2916869-83-3 is the registry number for ((1R)-1-Methoxy-6-methylenetetrahydro-1H-pyrrolizin-7a(5H)-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1R)-1-methoxy-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methanol (CAS 2916869-83-3) is a chemical compound with the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. IUPAC name: [(1R)-1-methoxy-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methanol. InChIKey: QNEQTFCETYFZED-YHMJZVADSA-N.
| Molecular formula | C10H17NO2 |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | [(1R)-1-methoxy-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methanol |
| InChIKey | QNEQTFCETYFZED-YHMJZVADSA-N |
| SMILES | CO[C@@H]1CCN2C1(CC(=C)C2)CO |
Computed by PubChem (NCBI)