CAS 29179-41-7 appears in our catalog under these names: 4,5-Dihydronaphtho[1,2-b]thiophene-2-carboxylic acid, 95%, 4,5-Dihydronaphtho[1,2-b]thiophene-2-carboxylic acid, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 250mg, 1g, 50mg.
4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid (CAS 29179-41-7) is a chemical compound with the molecular formula C13H10O2S and a molecular weight of 230.28 g/mol. IUPAC name: 4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid. InChIKey: IGBRCZHGFVMFCR-UHFFFAOYSA-N.
| Molecular formula | C13H10O2S |
|---|---|
| Molecular weight | 230.28 g/mol |
| IUPAC name | 4,5-dihydrobenzo[g][1]benzothiole-2-carboxylic acid |
| InChIKey | IGBRCZHGFVMFCR-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C3=CC=CC=C31)SC(=C2)C(=O)O |
Computed by PubChem (NCBI)