Products 40327-67-1
CAS 40327-67-1 is the registry number for (3-Phenyloxiran-2-yl)(thiophen-2-yl)methanone 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(3-phenyloxiran-2-yl)-thiophen-2-ylmethanone (CAS 40327-67-1) is a chemical compound with the molecular formula C13H10O2S and a molecular weight of 230.28 g/mol. IUPAC name: (3-phenyloxiran-2-yl)-thiophen-2-ylmethanone. InChIKey: MHMVFBXEHDEXIJ-UHFFFAOYSA-N.
| Molecular formula | C13H10O2S |
|---|---|
| Molecular weight | 230.28 g/mol |
| IUPAC name | (3-phenyloxiran-2-yl)-thiophen-2-ylmethanone |
| InChIKey | MHMVFBXEHDEXIJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2C(O2)C(=O)C3=CC=CS3 |
Computed by PubChem (NCBI)