CAS 58267-95-1 appears in our catalog under these names: (E)-3-(5-Phenylthiophen-2-yl)acrylic acid, 95%, (E)-3-(5-Phenylthiophen-2-yl)acrylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 2,5g.
(E)-3-(5-phenylthiophen-2-yl)prop-2-enoic acid (CAS 58267-95-1) is a chemical compound with the molecular formula C13H10O2S and a molecular weight of 230.28 g/mol. IUPAC name: (E)-3-(5-phenylthiophen-2-yl)prop-2-enoic acid. InChIKey: UMDVSCUPOVDRQE-VQHVLOKHSA-N.
| Molecular formula | C13H10O2S |
|---|---|
| Molecular weight | 230.28 g/mol |
| IUPAC name | (E)-3-(5-phenylthiophen-2-yl)prop-2-enoic acid |
| InChIKey | UMDVSCUPOVDRQE-VQHVLOKHSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(S2)/C=C/C(=O)O |
Computed by PubChem (NCBI)