CAS 649770-58-1 is the registry number for 4'-Mercapto-(1,1'-biphenyl)-4-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 250mg.
4-(4-sulfanylphenyl)benzoic acid (CAS 649770-58-1) is a chemical compound with the molecular formula C13H10O2S and a molecular weight of 230.28 g/mol. IUPAC name: 4-(4-sulfanylphenyl)benzoic acid. InChIKey: IKKPYNQATXPOCZ-UHFFFAOYSA-N.
| Molecular formula | C13H10O2S |
|---|---|
| Molecular weight | 230.28 g/mol |
| IUPAC name | 4-(4-sulfanylphenyl)benzoic acid |
| InChIKey | IKKPYNQATXPOCZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)S)C(=O)O |
Computed by PubChem (NCBI)