Products 5912-44-7
CAS 5912-44-7 appears in our catalog under these names: Tiaprofenic Acid EP Impurity B, 1-(5-Benzoyl-2-thienyl)ethanone, >95% (HPLC), 1-(5-Benzoylthiophen-2-yl)ethanone. Offered by: Chemat Brand, TRC, Mikromol. Available pack sizes: on request, 250mg, 500mg, 50mg, 25mg.
1-(5-benzoylthiophen-2-yl)ethanone (CAS 5912-44-7) is a chemical compound with the molecular formula C13H10O2S and a molecular weight of 230.28 g/mol. IUPAC name: 1-(5-benzoylthiophen-2-yl)ethanone. InChIKey: AOSMQOCUPQWEQF-UHFFFAOYSA-N.
| Molecular formula | C13H10O2S |
|---|---|
| Molecular weight | 230.28 g/mol |
| IUPAC name | 1-(5-benzoylthiophen-2-yl)ethanone |
| InChIKey | AOSMQOCUPQWEQF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(S1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
1-(5-Benzoyl-2-thienyl)ethanone, 1-(5-benzoylthiophen-2-yl)ethanone, 1-(5-Benzoylthiophen-2-yl)ethan-1-one, Ethanone, 1-(5-benzoyl-2-thienyl)-, Tiaprofenic acid impurity B [EP], Tiaprofenic acid impurity B, TIAPROFENIC ACID IMPURITY B [EP IMPURITY], TIAPROFENIC ACID IMPURITY B (EP IMPURITY), Tiaprofenic Acid EP Impurity B, 5-benzoyl-2-acetylthiophene