Products 2918892-94-9
CAS 2918892-94-9 is the registry number for (2,3-dichloropyridin-4-yl)(phenyl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2,3-dichloro-4-pyridinyl)-phenylmethanol (CAS 2918892-94-9) is a chemical compound with the molecular formula C12H9Cl2NO and a molecular weight of 254.11 g/mol. IUPAC name: (2,3-dichloro-4-pyridinyl)-phenylmethanol. InChIKey: GVIAVMFLHPJRAQ-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2NO |
|---|---|
| Molecular weight | 254.11 g/mol |
| IUPAC name | (2,3-dichloro-4-pyridinyl)-phenylmethanol |
| InChIKey | GVIAVMFLHPJRAQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=C(C(=NC=C2)Cl)Cl)O |
Computed by PubChem (NCBI)