CAS 29198-41-2 appears in our catalog under these names: 2-(Aminomethyl)-1,3-benzothiazole hydrochloride, 1,3-Benzothiazol-2-ylmethylamine hydrochloride, 95% , Benzo(d)thiazol-2-ylmethanamine hydrochloride, 95%, Benzo[d]thiazol-2-ylmethanamine hydrochloride, 95%, Benzo[d]thiazol-2-ylmethanamine hydrochloride, 95%, 95%. Offered by: Biosynth, Thermo Scientific, AmBeed, Fluorochem, Chemat. Available pack sizes: 0,05g, 0,1g, 0,25g, 250MG, 1g, 100mg.
1,3-benzothiazol-2-ylmethanamine;hydrochloride (CAS 29198-41-2) is a chemical compound with the molecular formula C8H9ClN2S and a molecular weight of 200.69 g/mol. IUPAC name: 1,3-benzothiazol-2-ylmethanamine;hydrochloride. InChIKey: WCZDQDCFSDCIIC-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2S |
|---|---|
| Molecular weight | 200.69 g/mol |
| IUPAC name | 1,3-benzothiazol-2-ylmethanamine;hydrochloride |
| InChIKey | WCZDQDCFSDCIIC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)CN.Cl |
Computed by PubChem (NCBI)