CAS 63980-71-2 appears in our catalog under these names: 1-(4-Chloro-2-methylphenyl)-2-thiourea, 1-(4-Chloro-2-methylphenyl)-2-thiourea, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 10g, 1g, 5g.
(4-chloro-2-methylphenyl)thiourea (CAS 63980-71-2) is a chemical compound with the molecular formula C8H9ClN2S and a molecular weight of 200.69 g/mol. IUPAC name: (4-chloro-2-methylphenyl)thiourea. InChIKey: ZTEGMOSORJUJFG-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2S |
|---|---|
| Molecular weight | 200.69 g/mol |
| IUPAC name | (4-chloro-2-methylphenyl)thiourea |
| InChIKey | ZTEGMOSORJUJFG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)NC(=S)N |
Computed by PubChem (NCBI)