CAS 89802-75-5 is the registry number for Sulconazole Nitrate Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.
(3-chlorophenyl)methyl carbamimidothioate (CAS 89802-75-5) is a chemical compound with the molecular formula C8H9ClN2S and a molecular weight of 200.69 g/mol. IUPAC name: (3-chlorophenyl)methyl carbamimidothioate. InChIKey: MMDKGIZKDGPYFQ-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2S |
|---|---|
| Molecular weight | 200.69 g/mol |
| IUPAC name | (3-chlorophenyl)methyl carbamimidothioate |
| InChIKey | MMDKGIZKDGPYFQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CSC(=N)N |
Computed by PubChem (NCBI)