CAS 67170-69-8 is the registry number for 2-Methyl-1,3-benzothiazol-6-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 25g, 5g.
2-methyl-1,3-benzothiazol-6-amine;hydrochloride (CAS 67170-69-8) is a chemical compound with the molecular formula C8H9ClN2S and a molecular weight of 200.69 g/mol. IUPAC name: 2-methyl-1,3-benzothiazol-6-amine;hydrochloride. InChIKey: JGHKJNZWFRQYTL-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2S |
|---|---|
| Molecular weight | 200.69 g/mol |
| IUPAC name | 2-methyl-1,3-benzothiazol-6-amine;hydrochloride |
| InChIKey | JGHKJNZWFRQYTL-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C=C(C=C2)N.Cl |
Computed by PubChem (NCBI)