CAS 64036-72-2 is the registry number for 4-Methylbenzo[d]thiazol-2-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methyl-1,3-benzothiazol-2-amine;hydrochloride (CAS 64036-72-2) is a chemical compound with the molecular formula C8H9ClN2S and a molecular weight of 200.69 g/mol. IUPAC name: 4-methyl-1,3-benzothiazol-2-amine;hydrochloride. InChIKey: KNAIBOSDRKAJKG-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2S |
|---|---|
| Molecular weight | 200.69 g/mol |
| IUPAC name | 4-methyl-1,3-benzothiazol-2-amine;hydrochloride |
| InChIKey | KNAIBOSDRKAJKG-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)SC(=N2)N.Cl |
Computed by PubChem (NCBI)