Products 2920231-94-1
CAS 2920231-94-1 is the registry number for 4-iodo-1,5-dimethyl-1H-imidazole, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4R)-3,3-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid (CAS 2920231-94-1) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: (4R)-3,3-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid. InChIKey: DKGQPLGHECGNRI-VIFPVBQESA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | (4R)-3,3-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid |
| InChIKey | DKGQPLGHECGNRI-VIFPVBQESA-N |
| SMILES | CC1(CN(CC[C@H]1C(=O)O)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)