Products 2921714-86-3
CAS 2921714-86-3 is the registry number for 1-(2,6-difluoropyridin-3-yl)cyclopentanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(2,6-difluoro-3-pyridinyl)cyclopentan-1-ol (CAS 2921714-86-3) is a chemical compound with the molecular formula C10H11F2NO and a molecular weight of 199.20 g/mol. IUPAC name: 1-(2,6-difluoro-3-pyridinyl)cyclopentan-1-ol. InChIKey: FANMTYPVIQNBAA-UHFFFAOYSA-N.
| Molecular formula | C10H11F2NO |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 1-(2,6-difluoro-3-pyridinyl)cyclopentan-1-ol |
| InChIKey | FANMTYPVIQNBAA-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=C(N=C(C=C2)F)F)O |
Computed by PubChem (NCBI)