Products 2921905-84-0
CAS 2921905-84-0 is the registry number for (2,6-difluoropyridin-3-yl)(phenyl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2,6-difluoro-3-pyridinyl)-phenylmethanol (CAS 2921905-84-0) is a chemical compound with the molecular formula C12H9F2NO and a molecular weight of 221.20 g/mol. IUPAC name: (2,6-difluoro-3-pyridinyl)-phenylmethanol. InChIKey: XYYXXMCEPKLVLZ-UHFFFAOYSA-N.
| Molecular formula | C12H9F2NO |
|---|---|
| Molecular weight | 221.20 g/mol |
| IUPAC name | (2,6-difluoro-3-pyridinyl)-phenylmethanol |
| InChIKey | XYYXXMCEPKLVLZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=C(N=C(C=C2)F)F)O |
Computed by PubChem (NCBI)