CAS 2923000-93-3 is the registry number for 2H-Spiro[benzofuran-3,1'-cyclopropane]-2'-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Spiro[2H-1-benzofuran-3,2'-cyclopropane]-1'-carboxylic acid (CAS 2923000-93-3) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: spiro[2H-1-benzofuran-3,2'-cyclopropane]-1'-carboxylic acid. InChIKey: DVPIYODLVCWWEE-UHFFFAOYSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | spiro[2H-1-benzofuran-3,2'-cyclopropane]-1'-carboxylic acid |
| InChIKey | DVPIYODLVCWWEE-UHFFFAOYSA-N |
| SMILES | C1C(C12COC3=CC=CC=C23)C(=O)O |
Computed by PubChem (NCBI)