Products 2923000-93-3

CAS 2923000-93-3 is the registry number for 2H-Spiro[benzofuran-3,1'-cyclopropane]-2'-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Spiro[2H-1-benzofuran-3,2'-cyclopropane]-1'-carboxylic acid (CAS 2923000-93-3) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: spiro[2H-1-benzofuran-3,2'-cyclopropane]-1'-carboxylic acid. InChIKey: DVPIYODLVCWWEE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10O3
Molecular weight190.19 g/mol
IUPAC namespiro[2H-1-benzofuran-3,2'-cyclopropane]-1'-carboxylic acid
InChIKeyDVPIYODLVCWWEE-UHFFFAOYSA-N
SMILESC1C(C12COC3=CC=CC=C23)C(=O)O

Computed by PubChem (NCBI)