CAS 2923228-85-5 is the registry number for 8-Bromo-7-chlorochromane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-7-chloro-3,4-dihydro-2H-chromene (CAS 2923228-85-5) is a chemical compound with the molecular formula C9H8BrClO and a molecular weight of 247.51 g/mol. IUPAC name: 8-bromo-7-chloro-3,4-dihydro-2H-chromene. InChIKey: ACTOLGHHNJHFIE-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO |
|---|---|
| Molecular weight | 247.51 g/mol |
| IUPAC name | 8-bromo-7-chloro-3,4-dihydro-2H-chromene |
| InChIKey | ACTOLGHHNJHFIE-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=C(C=C2)Cl)Br)OC1 |
Computed by PubChem (NCBI)