Products 2925099-31-4
CAS 2925099-31-4 is the registry number for CRBN ligand-715. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(2,4-dioxo-1,3-diazinan-1-yl)-2-methylindazole-6-carbaldehyde (CAS 2925099-31-4) is a chemical compound with the molecular formula C13H12N4O3 and a molecular weight of 272.26 g/mol. IUPAC name: 4-(2,4-dioxo-1,3-diazinan-1-yl)-2-methylindazole-6-carbaldehyde. InChIKey: UYGXDNUDNACDEC-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O3 |
|---|---|
| Molecular weight | 272.26 g/mol |
| IUPAC name | 4-(2,4-dioxo-1,3-diazinan-1-yl)-2-methylindazole-6-carbaldehyde |
| InChIKey | UYGXDNUDNACDEC-UHFFFAOYSA-N |
| SMILES | CN1C=C2C(=CC(=CC2=N1)C=O)N3CCC(=O)NC3=O |
Computed by PubChem (NCBI)