CAS 2925737-61-5 is the registry number for 4,6-Dichloro-3-methylpyrazolo[1,5-a]pyrazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dichloro-3-methylpyrazolo[1,5-a]pyrazine (CAS 2925737-61-5) is a chemical compound with the molecular formula C7H5Cl2N3 and a molecular weight of 202.04 g/mol. IUPAC name: 4,6-dichloro-3-methylpyrazolo[1,5-a]pyrazine. InChIKey: QNDWGCOXWDHCHW-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2N3 |
|---|---|
| Molecular weight | 202.04 g/mol |
| IUPAC name | 4,6-dichloro-3-methylpyrazolo[1,5-a]pyrazine |
| InChIKey | QNDWGCOXWDHCHW-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NC(=CN2N=C1)Cl)Cl |
Computed by PubChem (NCBI)