CAS 29268-17-5 is the registry number for (2R)-2-Benzenesulfonamidopropanoic Acid. Offered by: TRC. Available pack sizes: 1g.
(2R)-2-(benzenesulfonamido)propanoic acid (CAS 29268-17-5) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: (2R)-2-(benzenesulfonamido)propanoic acid. InChIKey: KHLXTMZRKBVYST-SSDOTTSWSA-N.
| Molecular formula | C9H11NO4S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | (2R)-2-(benzenesulfonamido)propanoic acid |
| InChIKey | KHLXTMZRKBVYST-SSDOTTSWSA-N |
| SMILES | C[C@H](C(=O)O)NS(=O)(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)