Products 42908-31-6
CAS 42908-31-6 appears in our catalog under these names: 2-[(Phenylsulfonyl)amino]propanoic acid, 95%, 2-Benzenesulfonamidopropanoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 0,5g.
(2S)-2-(benzenesulfonamido)propanoic acid (CAS 42908-31-6) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: (2S)-2-(benzenesulfonamido)propanoic acid. InChIKey: KHLXTMZRKBVYST-ZETCQYMHSA-N.
| Molecular formula | C9H11NO4S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | (2S)-2-(benzenesulfonamido)propanoic acid |
| InChIKey | KHLXTMZRKBVYST-ZETCQYMHSA-N |
| SMILES | C[C@@H](C(=O)O)NS(=O)(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)
Synonyms:
(S)-2-(phenylsulfonamido)propanoic acid, (2S)-2-benzenesulfonamidopropanoic acid, (2S)-2-[(phenylsulfonyl)amino]propanoic acid, (2S)-2-(benzenesulfonamido)propanoic acid, Alanine, N-(phenylsulfonyl)-, L-alanine, N-(phenylsulfonyl)-, (S)-2-((Phenylsulfonyl)amino)propanoic acid, N-(Phenylsulfonyl)-L-alanine, N-benzenesulfonylalanine, (phenylsulfonyl)-L-alanine