Products 29278-69-1
CAS 29278-69-1 appears in our catalog under these names: PBT Impurity 8, 1,4-Butanediol Terephthalate, >95% (HPLC), 1,4-Butanediol Terephthalate (>80%), 1,4-Benzenedicarboxylic acid,1,4-butanediyl ester, 95%+, 95%+. Offered by: Chemat Brand, TRC, Chemat. Available pack sizes: on request, 100mg, 250mg, 25mg, 500mg.
3,8-dioxabicyclo[8.2.2]tetradeca-1(12),10,13-triene-2,9-dione (CAS 29278-69-1) is a chemical compound with the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. IUPAC name: 3,8-dioxabicyclo[8.2.2]tetradeca-1(12),10,13-triene-2,9-dione. InChIKey: WSQZNZLOZXSBHA-UHFFFAOYSA-N.
| Molecular formula | C12H12O4 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 3,8-dioxabicyclo[8.2.2]tetradeca-1(12),10,13-triene-2,9-dione |
| InChIKey | WSQZNZLOZXSBHA-UHFFFAOYSA-N |
| SMILES | C1CCOC(=O)C2=CC=C(C=C2)C(=O)OC1 |
Computed by PubChem (NCBI)