Products 2928181-97-7
CAS 2928181-97-7 is the registry number for Diphenidol–d10. Offered by: GLPBio. Available pack sizes: 1mg, 5mg, 500μg.
4-(2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidin-1-yl)-1,1-diphenylbutan-1-ol (CAS 2928181-97-7) is a chemical compound with the molecular formula C21H27NO and a molecular weight of 319.5 g/mol. IUPAC name: 4-(2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidin-1-yl)-1,1-diphenylbutan-1-ol. InChIKey: OGAKLTJNUQRZJU-FNJHSXSFSA-N.
| Molecular formula | C21H27NO |
|---|---|
| Molecular weight | 319.5 g/mol |
| IUPAC name | 4-(2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidin-1-yl)-1,1-diphenylbutan-1-ol |
| InChIKey | OGAKLTJNUQRZJU-FNJHSXSFSA-N |
| SMILES | [2H]C1(C(C(N(C(C1([2H])[2H])([2H])[2H])CCCC(C2=CC=CC=C2)(C3=CC=CC=C3)O)([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
Diphenidol-d10, Diphenadol-d10