Products 81576-47-8
CAS 81576-47-8 appears in our catalog under these names: (S,R)-N-(1-Phenylethyl) Ibuprofen Amide, >95% (HPLC), (2SR)-2-(4-Isobutylphenyl)-N-((RS)-1-phenylethyl)propanamide. Offered by: TRC, Mikromol. Available pack sizes: 25mg, 50mg, 5mg, 100mg.
(2R)-2-[4-(2-methylpropyl)phenyl]-N-[(1S)-1-phenylethyl]propanamide (CAS 81576-47-8) is a chemical compound with the molecular formula C21H27NO and a molecular weight of 309.4 g/mol. IUPAC name: (2R)-2-[4-(2-methylpropyl)phenyl]-N-[(1S)-1-phenylethyl]propanamide. InChIKey: BLNIYEIMTLMHGY-SJORKVTESA-N.
| Molecular formula | C21H27NO |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | (2R)-2-[4-(2-methylpropyl)phenyl]-N-[(1S)-1-phenylethyl]propanamide |
| InChIKey | BLNIYEIMTLMHGY-SJORKVTESA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)CC(C)C)C(=O)N[C@@H](C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)