CAS 121734-80-3 appears in our catalog under these names: (R)-2-(4-Isobutylphenyl)-N-((R)-1-phenylethyl)propanamide, 98%, (R,R)-N-(1-Phenylethyl) Ibuprofen Amide, >95% (HPLC), (R,R)-N-(1-Phenylethyl) ibuprofen amide, (2SR)-2-(4-Isobutylphenyl)-N-((SR)-1-phenylethyl)propanamide. Offered by: Chemat Brand, TRC, Biosynth, Mikromol. Available pack sizes: on request, 5mg, 2mg, 10mg, 25mg, 50mg, 4x25mg.
(2R)-2-[4-(2-methylpropyl)phenyl]-N-[(1R)-1-phenylethyl]propanamide (CAS 121734-80-3) is a chemical compound with the molecular formula C21H27NO and a molecular weight of 309.4 g/mol. IUPAC name: (2R)-2-[4-(2-methylpropyl)phenyl]-N-[(1R)-1-phenylethyl]propanamide. InChIKey: BLNIYEIMTLMHGY-IAGOWNOFSA-N.
| Molecular formula | C21H27NO |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | (2R)-2-[4-(2-methylpropyl)phenyl]-N-[(1R)-1-phenylethyl]propanamide |
| InChIKey | BLNIYEIMTLMHGY-IAGOWNOFSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)CC(C)C)C(=O)N[C@H](C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)