Products 561-10-4
CAS 561-10-4 is the registry number for (5S)-Isomethadone. Offered by: TRC. Available pack sizes: 100mg.
(5S)-6-(dimethylamino)-5-methyl-4,4-diphenylhexan-3-one (CAS 561-10-4) is a chemical compound with the molecular formula C21H27NO and a molecular weight of 309.4 g/mol. IUPAC name: (5S)-6-(dimethylamino)-5-methyl-4,4-diphenylhexan-3-one. InChIKey: IFKPLJWIEQBPGG-QGZVFWFLSA-N.
| Molecular formula | C21H27NO |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | (5S)-6-(dimethylamino)-5-methyl-4,4-diphenylhexan-3-one |
| InChIKey | IFKPLJWIEQBPGG-QGZVFWFLSA-N |
| SMILES | CCC(=O)C(C1=CC=CC=C1)(C2=CC=CC=C2)[C@H](C)CN(C)C |
Computed by PubChem (NCBI)