CAS 150085-21-5 appears in our catalog under these names: S1R agonist 2, S1R agonist 2, 98%, S1R agonist 2/ 99.04% (existing batch purity), 1-(3-Phenoxypropyl)-4-(phenylmethyl)piperidine, 98%, 98%, S1R agonist 2, 98.0%. Offered by: GLPBio, AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
4-benzyl-1-(3-phenoxypropyl)piperidine (CAS 150085-21-5) is a chemical compound with the molecular formula C21H27NO and a molecular weight of 309.4 g/mol. IUPAC name: 4-benzyl-1-(3-phenoxypropyl)piperidine. InChIKey: KOYQYIAABUPJFF-UHFFFAOYSA-N.
| Molecular formula | C21H27NO |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | 4-benzyl-1-(3-phenoxypropyl)piperidine |
| InChIKey | KOYQYIAABUPJFF-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1CC2=CC=CC=C2)CCCOC3=CC=CC=C3 |
Computed by PubChem (NCBI)