Products 2934585-67-6

CAS 2934585-67-6 is the registry number for 2-Amino-3-(3-methoxy-4-methylphenyl)propanoic acid hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

2-amino-3-(3-methoxy-4-methylphenyl)propanoic acid;hydrochloride (CAS 2934585-67-6) is a chemical compound with the molecular formula C11H16ClNO3 and a molecular weight of 245.70 g/mol. IUPAC name: 2-amino-3-(3-methoxy-4-methylphenyl)propanoic acid;hydrochloride. InChIKey: LSOUOKNCNWPAJB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16ClNO3
Molecular weight245.70 g/mol
IUPAC name2-amino-3-(3-methoxy-4-methylphenyl)propanoic acid;hydrochloride
InChIKeyLSOUOKNCNWPAJB-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)CC(C(=O)O)N)OC.Cl

Computed by PubChem (NCBI)