CAS 293737-84-5 is the registry number for 2-(2,5-Dichlorophenyl)benzo(D)oxazol-5-amine. Offered by: Biosynth. Available pack sizes: 25g, 10g.
2-(2,5-dichlorophenyl)-1,3-benzoxazol-5-amine (CAS 293737-84-5) is a chemical compound with the molecular formula C13H8Cl2N2O and a molecular weight of 279.12 g/mol. IUPAC name: 2-(2,5-dichlorophenyl)-1,3-benzoxazol-5-amine. InChIKey: CEBMGSOURCAPDC-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2N2O |
|---|---|
| Molecular weight | 279.12 g/mol |
| IUPAC name | 2-(2,5-dichlorophenyl)-1,3-benzoxazol-5-amine |
| InChIKey | CEBMGSOURCAPDC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)N=C(O2)C3=C(C=CC(=C3)Cl)Cl |
Computed by PubChem (NCBI)