Products 2938875-37-5
CAS 2938875-37-5 is the registry number for Methyl (R)-4-Nitro-3-[(oxetan-2-ylmethyl)amino]benzoate, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Methyl 4-nitro-3-(oxetan-2-ylmethylamino)benzoate (CAS 2938875-37-5) is a chemical compound with the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. IUPAC name: methyl 4-nitro-3-(oxetan-2-ylmethylamino)benzoate. InChIKey: HTYWVEUBCLGQES-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O5 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | methyl 4-nitro-3-(oxetan-2-ylmethylamino)benzoate |
| InChIKey | HTYWVEUBCLGQES-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)[N+](=O)[O-])NCC2CCO2 |
Computed by PubChem (NCBI)