Products 2939824-98-1
CAS 2939824-98-1 is the registry number for N-(4-Bromo-2-(3-methoxybenzoyl)phenyl)acetamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
N-[4-bromo-2-(3-methoxybenzoyl)phenyl]acetamide (CAS 2939824-98-1) is a chemical compound with the molecular formula C16H14BrNO3 and a molecular weight of 348.19 g/mol. IUPAC name: N-[4-bromo-2-(3-methoxybenzoyl)phenyl]acetamide. InChIKey: KWMGINLXLSXUIV-UHFFFAOYSA-N.
| Molecular formula | C16H14BrNO3 |
|---|---|
| Molecular weight | 348.19 g/mol |
| IUPAC name | N-[4-bromo-2-(3-methoxybenzoyl)phenyl]acetamide |
| InChIKey | KWMGINLXLSXUIV-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)Br)C(=O)C2=CC(=CC=C2)OC |
Computed by PubChem (NCBI)