CAS 72370-19-5 appears in our catalog under these names: 5-(2-Bromoacetyl)-2-(phenylmethoxy)benzamide, Labetalol Hydrochloride Impurity 18. Offered by: TRC, Hubei YoungXin. Available pack sizes: 100mg, 1g, 250mg, 10mg, 25mg, 50mg, 200mg.
5-(2-bromoacetyl)-2-phenylmethoxybenzamide (CAS 72370-19-5) is a chemical compound with the molecular formula C16H14BrNO3 and a molecular weight of 348.19 g/mol. IUPAC name: 5-(2-bromoacetyl)-2-phenylmethoxybenzamide. InChIKey: LUQQESVFZAPODX-UHFFFAOYSA-N.
| Molecular formula | C16H14BrNO3 |
|---|---|
| Molecular weight | 348.19 g/mol |
| IUPAC name | 5-(2-bromoacetyl)-2-phenylmethoxybenzamide |
| InChIKey | LUQQESVFZAPODX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)C(=O)CBr)C(=O)N |
Computed by PubChem (NCBI)