Products 307001-06-5
CAS 307001-06-5 is the registry number for CMP233. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-bromo-2-(3-phenylpropanoylamino)benzoic acid (CAS 307001-06-5) is a chemical compound with the molecular formula C16H14BrNO3 and a molecular weight of 348.19 g/mol. IUPAC name: 5-bromo-2-(3-phenylpropanoylamino)benzoic acid. InChIKey: BSRFCROCELMSLQ-UHFFFAOYSA-N.
| Molecular formula | C16H14BrNO3 |
|---|---|
| Molecular weight | 348.19 g/mol |
| IUPAC name | 5-bromo-2-(3-phenylpropanoylamino)benzoic acid |
| InChIKey | BSRFCROCELMSLQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC(=O)NC2=C(C=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)