CAS 2750500-27-5 is the registry number for (R)-4-(4-Bromobenzyl)-3,4-dihydro-2H-benzo[b][1,4]oxazine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-4-[(4-bromophenyl)methyl]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid (CAS 2750500-27-5) is a chemical compound with the molecular formula C16H14BrNO3 and a molecular weight of 348.19 g/mol. IUPAC name: (2R)-4-[(4-bromophenyl)methyl]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid. InChIKey: HPXRSWXGPOAURU-OAHLLOKOSA-N.
| Molecular formula | C16H14BrNO3 |
|---|---|
| Molecular weight | 348.19 g/mol |
| IUPAC name | (2R)-4-[(4-bromophenyl)methyl]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
| InChIKey | HPXRSWXGPOAURU-OAHLLOKOSA-N |
| SMILES | C1[C@@H](OC2=CC=CC=C2N1CC3=CC=C(C=C3)Br)C(=O)O |
Computed by PubChem (NCBI)