CAS 552843-27-3 is the registry number for 2-(4-Bromo-2-formylphenoxy)-N-(4-methylphenyl)acetamide. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-(4-bromo-2-formylphenoxy)-N-(4-methylphenyl)acetamide (CAS 552843-27-3) is a chemical compound with the molecular formula C16H14BrNO3 and a molecular weight of 348.19 g/mol. IUPAC name: 2-(4-bromo-2-formylphenoxy)-N-(4-methylphenyl)acetamide. InChIKey: PUTQCFXXVRMLCF-UHFFFAOYSA-N.
| Molecular formula | C16H14BrNO3 |
|---|---|
| Molecular weight | 348.19 g/mol |
| IUPAC name | 2-(4-bromo-2-formylphenoxy)-N-(4-methylphenyl)acetamide |
| InChIKey | PUTQCFXXVRMLCF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC(=O)COC2=C(C=C(C=C2)Br)C=O |
Computed by PubChem (NCBI)