CAS 2445168-29-4 appears in our catalog under these names: Bromfenac Impurity 29, Bromfenac Methyl Ester. Offered by: Chemat Brand, TRC, Mikromol. Available pack sizes: on request, 100mg, 250mg, 50mg, 25mg.
Methyl 2-[2-amino-3-(4-bromobenzoyl)phenyl]acetate (CAS 2445168-29-4) is a chemical compound with the molecular formula C16H14BrNO3 and a molecular weight of 348.19 g/mol. IUPAC name: methyl 2-[2-amino-3-(4-bromobenzoyl)phenyl]acetate. InChIKey: RTFZGDZYUBFGKT-UHFFFAOYSA-N.
| Molecular formula | C16H14BrNO3 |
|---|---|
| Molecular weight | 348.19 g/mol |
| IUPAC name | methyl 2-[2-amino-3-(4-bromobenzoyl)phenyl]acetate |
| InChIKey | RTFZGDZYUBFGKT-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C(C(=CC=C1)C(=O)C2=CC=C(C=C2)Br)N |
Computed by PubChem (NCBI)