CAS 2940858-17-1 is the registry number for methyl cis-4-amino-1-methyl-pyrrolidine-3-carboxylate dihydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (3R,4R)-4-amino-1-methylpyrrolidine-3-carboxylate;dihydrochloride (CAS 2940858-17-1) is a chemical compound with the molecular formula C7H16Cl2N2O2 and a molecular weight of 231.12 g/mol. IUPAC name: methyl (3R,4R)-4-amino-1-methylpyrrolidine-3-carboxylate;dihydrochloride. InChIKey: WTWBZDMYGRTXFD-PVNUIUKASA-N.
| Molecular formula | C7H16Cl2N2O2 |
|---|---|
| Molecular weight | 231.12 g/mol |
| IUPAC name | methyl (3R,4R)-4-amino-1-methylpyrrolidine-3-carboxylate;dihydrochloride |
| InChIKey | WTWBZDMYGRTXFD-PVNUIUKASA-N |
| SMILES | CN1C[C@H]([C@H](C1)N)C(=O)OC.Cl.Cl |
Computed by PubChem (NCBI)