Products 1001354-15-9

CAS 1001354-15-9 is the registry number for (4S)-4-(Dimethylamino)-l-proline dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(2S,4S)-4-(dimethylamino)pyrrolidine-2-carboxylic acid;dihydrochloride (CAS 1001354-15-9) is a chemical compound with the molecular formula C7H16Cl2N2O2 and a molecular weight of 231.12 g/mol. IUPAC name: (2S,4S)-4-(dimethylamino)pyrrolidine-2-carboxylic acid;dihydrochloride. InChIKey: DVNGWXJSRQYBCM-USPAICOZSA-N.

Identity
Molecular formulaC7H16Cl2N2O2
Molecular weight231.12 g/mol
IUPAC name(2S,4S)-4-(dimethylamino)pyrrolidine-2-carboxylic acid;dihydrochloride
InChIKeyDVNGWXJSRQYBCM-USPAICOZSA-N
SMILESCN(C)[C@H]1C[C@H](NC1)C(=O)O.Cl.Cl

Computed by PubChem (NCBI)