Products 1300698-39-8

CAS 1300698-39-8 is the registry number for Methyl (4s)-4-amino-1-methyl-l-prolinate dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl (2S,4S)-4-amino-1-methylpyrrolidine-2-carboxylate;dihydrochloride (CAS 1300698-39-8) is a chemical compound with the molecular formula C7H16Cl2N2O2 and a molecular weight of 231.12 g/mol. IUPAC name: methyl (2S,4S)-4-amino-1-methylpyrrolidine-2-carboxylate;dihydrochloride. InChIKey: KRVAEZGAEYMPOS-USPAICOZSA-N.

Identity
Molecular formulaC7H16Cl2N2O2
Molecular weight231.12 g/mol
IUPAC namemethyl (2S,4S)-4-amino-1-methylpyrrolidine-2-carboxylate;dihydrochloride
InChIKeyKRVAEZGAEYMPOS-USPAICOZSA-N
SMILESCN1C[C@H](C[C@H]1C(=O)OC)N.Cl.Cl

Computed by PubChem (NCBI)