Products 1609388-50-2
CAS 1609388-50-2 appears in our catalog under these names: (4R)-4-(Dimethylamino)-l-proline dihydrochloride, 95%, (4R)-4-(Dimethylamino)-L-proline dihydrochloride, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 10g, 5g, 25g, 250mg, 1g, 100mg, 500mg.
(2S,4R)-4-(dimethylamino)pyrrolidine-2-carboxylic acid;dihydrochloride (CAS 1609388-50-2) is a chemical compound with the molecular formula C7H16Cl2N2O2 and a molecular weight of 231.12 g/mol. IUPAC name: (2S,4R)-4-(dimethylamino)pyrrolidine-2-carboxylic acid;dihydrochloride. InChIKey: DVNGWXJSRQYBCM-PVNUIUKASA-N.
| Molecular formula | C7H16Cl2N2O2 |
|---|---|
| Molecular weight | 231.12 g/mol |
| IUPAC name | (2S,4R)-4-(dimethylamino)pyrrolidine-2-carboxylic acid;dihydrochloride |
| InChIKey | DVNGWXJSRQYBCM-PVNUIUKASA-N |
| SMILES | CN(C)[C@@H]1C[C@H](NC1)C(=O)O.Cl.Cl |
Computed by PubChem (NCBI)