CAS 1609388-59-1 is the registry number for Methyl (4r)-4-amino-1-methyl-l-prolinate dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Methyl (2S,4R)-4-amino-1-methylpyrrolidine-2-carboxylate;dihydrochloride (CAS 1609388-59-1) is a chemical compound with the molecular formula C7H16Cl2N2O2 and a molecular weight of 231.12 g/mol. IUPAC name: methyl (2S,4R)-4-amino-1-methylpyrrolidine-2-carboxylate;dihydrochloride. InChIKey: KRVAEZGAEYMPOS-PVNUIUKASA-N.
| Molecular formula | C7H16Cl2N2O2 |
|---|---|
| Molecular weight | 231.12 g/mol |
| IUPAC name | methyl (2S,4R)-4-amino-1-methylpyrrolidine-2-carboxylate;dihydrochloride |
| InChIKey | KRVAEZGAEYMPOS-PVNUIUKASA-N |
| SMILES | CN1C[C@@H](C[C@H]1C(=O)OC)N.Cl.Cl |
Computed by PubChem (NCBI)