Products 2940858-92-2
CAS 2940858-92-2 is the registry number for tert-butyl trans-3-amino-4-ethyl-pyrrolidine-1-carboxylate,hydrochloride, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
Tert-butyl (3S,4R)-3-amino-4-ethylpyrrolidine-1-carboxylate;hydrochloride (CAS 2940858-92-2) is a chemical compound with the molecular formula C11H23ClN2O2 and a molecular weight of 250.76 g/mol. IUPAC name: tert-butyl (3S,4R)-3-amino-4-ethylpyrrolidine-1-carboxylate;hydrochloride. InChIKey: VSXNCYVERKBUBY-VTLYIQCISA-N.
| Molecular formula | C11H23ClN2O2 |
|---|---|
| Molecular weight | 250.76 g/mol |
| IUPAC name | tert-butyl (3S,4R)-3-amino-4-ethylpyrrolidine-1-carboxylate;hydrochloride |
| InChIKey | VSXNCYVERKBUBY-VTLYIQCISA-N |
| SMILES | CC[C@@H]1CN(C[C@H]1N)C(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)