Products 2940866-84-0
CAS 2940866-84-0 is the registry number for Methyl (3R,4R)-4-((tert-butoxycarbonyl)amino)pyrrolidine-3-carboxylate hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Methyl (3R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-3-carboxylate;hydrochloride (CAS 2940866-84-0) is a chemical compound with the molecular formula C11H21ClN2O4 and a molecular weight of 280.75 g/mol. IUPAC name: methyl (3R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-3-carboxylate;hydrochloride. InChIKey: GSLPBLHBGBKNKA-WLYNEOFISA-N.
| Molecular formula | C11H21ClN2O4 |
|---|---|
| Molecular weight | 280.75 g/mol |
| IUPAC name | methyl (3R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-3-carboxylate;hydrochloride |
| InChIKey | GSLPBLHBGBKNKA-WLYNEOFISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CNC[C@H]1C(=O)OC.Cl |
Computed by PubChem (NCBI)